CAS 4476-28-2: 4-(1-Methylethyl)benzeneacetic acid
Description:4-(1-Methylethyl)benzeneacetic acid, also known as 4-isobutylphenylacetic acid, is an organic compound characterized by its aromatic structure and carboxylic acid functional group. It features a benzene ring substituted with an isobutyl group at the para position relative to the acetic acid moiety. This compound typically appears as a solid or viscous liquid, depending on temperature, and is known for its potential applications in pharmaceuticals and organic synthesis. Its molecular structure contributes to its hydrophobic characteristics, which can influence its solubility in various solvents. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation or adverse reactions. Overall, 4-(1-Methylethyl)benzeneacetic acid is a compound of interest in both industrial and research settings due to its unique structural features and potential applications.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-8(2)10-5-3-9(4-6-10)7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13)
InChI key:InChIKey=RERBQXVRXYCGLT-UHFFFAOYSA-N
SMILES:O=C(O)CC1=CC=C(C=C1)C(C)C
- Synonyms:
- 2-(4-Isopropylphenyl)acetic acid
- 2-(4-Propan-2-ylphenyl)acetic acid
- 2-[4-(Propan-2-yl)phenyl]acetic acid
- 4-(1-Methylethyl)benzeneacetic acid
- 4-(Propan-2-yl)phenylacetic acid
- Ai3-12008
- Benzeneacetic acid, 4-(1-methylethyl)-
- [4-(1-Methylethyl)Phenyl]Acetate
- [4-(Propan-2-Yl)Phenyl]Acetic Acid
- p-Cymene-7-carboxylic acid
- See more synonyms
- p-Isopropylphenylacetic acid
