CAS 4479-74-7
:2,2'-bipyridine-6,6'-dicarboxylic acid
Description:
2,2'-Bipyridine-6,6'-dicarboxylic acid, with the CAS number 4479-74-7, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a carbon-carbon bond. This compound features two carboxylic acid groups (-COOH) located at the 6 and 6' positions of the bipyridine framework, contributing to its acidic properties. It is typically a white to off-white solid that is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid groups. The compound is known for its ability to form coordination complexes with transition metals, making it of interest in coordination chemistry and materials science. Its functional groups also allow for potential applications in organic synthesis and as a ligand in catalysis. Additionally, 2,2'-bipyridine-6,6'-dicarboxylic acid can exhibit interesting photophysical properties, which may be leveraged in various chemical and technological applications.
Formula:C12H8N2O4
InChI:InChI=1/C12H8N2O4/c15-11(16)9-5-1-3-7(13-9)8-4-2-6-10(14-8)12(17)18/h1-6H,(H,15,16)(H,17,18)
SMILES:c1cc(c2cccc(C(=O)O)n2)nc(c1)C(=O)O
Synonyms:- 2,2'-Bipyridin-6,6'-dicarbons?ure
- 2,2'-Bipyridine-6,6'-dicarboxylic acid
- [2,2'-bipyridine]-6,6'-dicarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2'-Bipyridine-6,6'-dicarboxylic Acid
CAS:Formula:C12H8N2O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:244.212,2'-Bipyridine-6,6'-dicarboxylic Acid
CAS:Formula:C12H8N2O4Purity:96%Color and Shape:SolidMolecular weight:244.20292,2'-Bipyridine-6,6'-dicarboxylic Acid
CAS:2,2'-Bipyridine-6,6'-dicarboxylic AcidPurity:96%Molecular weight:244.21g/mol2,2'-Bipyridine-6,6'-dicarboxylic acid
CAS:<p>2,2'-Bipyridine-6,6'-dicarboxylic acid</p>Purity:96%Molecular weight:244.21g/mol2,2'-Bipyridine-6,6'-dicarboxylic acid
CAS:<p>2,2'-Bipyridine-6,6'-dicarboxylic acid is a molecule that has an acidic functional group. It has been found to have a molecular weight of 220.2 g/mol and is soluble in water at elevated temperatures. 2,2'-Bipyridine-6,6'-dicarboxylic acid has been shown to be photoprocessable in the presence of sodium carbonate as a catalyst. The reaction rate can be increased by adding a diluent to the solution or by using linear models.</p>Formula:C12H8N2O4Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:244.21 g/mol[2,2′-Bipyridine]-6,6′-dicarboxylic acid
CAS:Formula:C12H8N2O4Purity:95%Color and Shape:SolidMolecular weight:244.206




