CAS 448-61-3: 2,4,6-Triphenylpyrylium tetrafluoroborate
Description:2,4,6-Triphenylpyrylium tetrafluoroborate is an organic compound characterized by its pyrylium cation structure, which consists of a six-membered aromatic ring containing one oxygen atom and three phenyl substituents at the 2, 4, and 6 positions. This compound is known for its bright color and strong absorption in the visible region, making it useful in various applications, including as a dye and in photochemical studies. The tetrafluoroborate anion, derived from boron trifluoride, is a stable and non-coordinating counterion that enhances the solubility of the pyrylium cation in polar solvents. 2,4,6-Triphenylpyrylium tetrafluoroborate exhibits notable electrochemical properties, allowing it to participate in redox reactions. Its stability and reactivity can be influenced by the presence of substituents on the phenyl rings, which can modulate its electronic properties. Overall, this compound serves as an important model in the study of pyrylium salts and their derivatives in organic chemistry.
Formula:C23H17O·BF4
InChI:InChI=1S/C23H17O.BF4/c1-4-10-18(11-5-1)21-16-22(19-12-6-2-7-13-19)24-23(17-21)20-14-8-3-9-15-20;2-1(3,4)5/h1-17H;/q+1;-1
InChI key:InChIKey=VQYPWMWEJGDSTF-UHFFFAOYSA-N
SMILES:[F-][B+3]([F-])([F-])[F-].[O+]=1C(=CC(=CC1C=2C=CC=CC2)C=3C=CC=CC3)C=4C=CC=CC4
- Synonyms:
- 2,4,6-Triphenylpyranium Tetrafluoroborate
- 2,4,6-Triphenylpyrylium fluoborate
- 2,4,6-Triphenylpyrylium fluoroborate
- Borate(1-), tetrafluoro-, 2,4,6-triphenylpyrylium
- Pyrylium, 2,4,6-triphenyl-, tetrafluoroborate(1-)
- Pyrylium, 2,4,6-triphenyl-, tetrafluoroborate(1-) (1:1)
- 2,4,6-Triphenylpyrylium tetrafluoroborate
