CymitQuimica logo

CAS 448-97-5

:

3,3'-difluorobiphenyl-4,4'-diamine

Description:
3,3'-Difluorobiphenyl-4,4'-diamine, with the CAS number 448-97-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two amino groups (-NH2) at the para positions of the biphenyl framework, along with two fluorine atoms at the meta positions, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its fluorine substituents can enhance its thermal stability and influence its reactivity, making it of interest in various applications, including materials science and organic synthesis. Additionally, the amino groups can participate in hydrogen bonding and may serve as reactive sites for further chemical modifications. Safety data indicates that, like many amines, it should be handled with care due to potential toxicity and irritant properties. Overall, 3,3'-difluorobiphenyl-4,4'-diamine is a versatile compound with potential applications in the development of dyes, polymers, and pharmaceuticals.
Formula:C12H10F2N2
InChI:InChI=1/C12H10F2N2/c13-9-5-7(1-3-11(9)15)8-2-4-12(16)10(14)6-8/h1-6H,15-16H2
InChI key:LVNPGQZSPDFZNC-UHFFFAOYSA-N
SMILES:c1cc(c(cc1c1ccc(c(c1)F)N)F)N
Synonyms:
  • [1,1'-Biphenyl]-4,4'-Diamine, 3,3'-Difluoro-
  • 3,3'-Difluorobiphenyl-4,4'-diamine
Found 4 products.