CAS 448250-78-0

4-{[2-(1-methylethyl)phenyl]amino}-4-oxobutanoic acid

Description:

4-{[2-(1-methylethyl)phenyl]amino}-4-oxobutanoic acid, with the CAS number 448250-78-0, is an organic compound characterized by its unique structure that includes an amino group, a ketone, and a carboxylic acid functional group. This compound features a butanoic acid backbone, which is substituted at the fourth position with a ketone and an amino group that is further substituted with a phenyl ring bearing an isopropyl group. The presence of these functional groups suggests that the compound may exhibit both acidic and basic properties, making it potentially useful in various chemical reactions and applications. Its molecular structure indicates that it could participate in hydrogen bonding due to the carboxylic acid and amino functionalities, which may influence its solubility and reactivity. Additionally, the presence of the isopropyl group may impart hydrophobic characteristics, affecting its interaction with biological systems or other solvents. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in medicinal chemistry or materials science.

Formula: C₁₃H₁₇NO₃

InChI: InChI=1/C13H17NO3/c1-9(2)10-5-3-4-6-11(10)14-12(15)7-8-13(16)17/h3-6,9H,7-8H2,1-2H3,(H,14,15)(H,16,17)

SMILES: CC(C)c1ccccc1N=C(CCC(=O)O)O

Synonyms:

• 4-[(2-Isopropylphenyl)amino]-4-oxobutanoic acid
• Butanoic Acid, 4-[[2-(1-Methylethyl)Phenyl]Amino]-4-Oxo-

4-[(2-isopropylphenyl)amino]-4-oxobutanoic acid

CAS: 448250-78-0

Formula: C₁₃H₁₇NO₃

Purity: 95.0%

Molecular weight: 235.283

Ref: 10-F310139