CAS 4483-47-0

1-(3,4-dimethoxyphenyl)-3-ethyl-5,6-dimethoxy-2-methyl-2,3-dihydro-1H-indene

Description:

1-(3,4-Dimethoxyphenyl)-3-ethyl-5,6-dimethoxy-2-methyl-2,3-dihydro-1H-indene, with the CAS number 4483-47-0, is an organic compound characterized by its complex structure, which includes an indene core substituted with various methoxy and ethyl groups. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for engaging in electrophilic substitution reactions due to the presence of electron-donating methoxy groups. The presence of multiple methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the indene framework suggests potential applications in organic synthesis and materials science. The compound's specific physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the arrangement of substituents. Overall, this compound may be of interest in medicinal chemistry and materials research due to its unique structural features and potential biological activity.

Formula: C₂₂H₂₈O₄

InChI: InChI=1/C22H28O4/c1-7-15-13(2)22(14-8-9-18(23-3)19(10-14)24-4)17-12-21(26-6)20(25-5)11-16(15)17/h8-13,15,22H,7H2,1-6H3

SMILES: CCC1C(C)C(c2ccc(c(c2)OC)OC)c2cc(c(cc12)OC)OC

Tofisopam Impurity 5

CAS: 4483-47-0

Formula: C₂₂H₂₈O₄

Color and Shape: White To Off-White Solid

Molecular weight: 356.46

Ref: 4Z-T-211006

Diisohomoeugenol

Controlled Product

CAS: 4483-47-0

Formula: C₂₂H₂₈O₄

Color and Shape: Neat

Molecular weight: 356.46

Ref: TR-D464435

Diisohomoeugenol

CAS: 4483-47-0

Diisohomoeugenol is a chemical compound, which is a plant-derived phenolic compound known for its biological activities. Sourced primarily from essential oils of various aromatic plants, it exhibits notable bioactive properties due to its structural similarity to other eugenol derivatives. Its mode of action involves disrupting microbial cell membranes, leading to enhanced antimicrobial effects. Additionally, it acts as a potent antioxidant, scavenging free radicals and protecting against oxidative stress.

Formula: C₂₂H₂₈O₄

Purity: Min. 95%

Molecular weight: 356.5 g/mol

Ref: 3D-EAA48347

Tofisopam Impurity 4

CAS: 4483-47-0

Formula: C₂₂H₂₈O₄

Molecular weight: 356.46

Ref: ST-EA-CP-T163004