CAS 4488-43-1
:5-Acenaphthylenecarboxylic acid
Description:
5-Acenaphthylenecarboxylic acid, with the CAS number 4488-43-1, is an organic compound characterized by its acenaphthylene structure, which consists of a fused bicyclic aromatic system. This compound features a carboxylic acid functional group (-COOH) attached to the 5-position of the acenaphthylene ring. It is typically a solid at room temperature and may exhibit a crystalline form. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 5-acenaphthylenecarboxylic acid can serve as a building block in organic synthesis, particularly in the development of dyes, pharmaceuticals, and other functional materials. Its aromatic nature contributes to its stability and potential applications in materials science. As with many organic compounds, it is important to handle it with care, observing appropriate safety protocols due to potential toxicity and environmental impact.
Formula:C13H8O2
InChI:InChI=1/C13H8O2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H,(H,14,15)
SMILES:c1cc2C=Cc3ccc(c(c1)c23)C(=O)O
Synonyms:- Acenaphthylene-5-carboxylic acid
- 5-acenaphthylenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Acenaphthylenecarboxylic acid
CAS:Controlled ProductApplications 5-Acenaphthylenecarboxylic acid is used as additives to plastic materials.
References Bi, G., et al.: Faming Zhuanli Shenqing, 2017;Formula:C13H8O2Color and Shape:NeatMolecular weight:196.201
