CAS 448895-37-2

1,3-bis[2-hydroxy-5-(trifluoromethyl)phenyl]urea

Description:

1,3-bis[2-hydroxy-5-(trifluoromethyl)phenyl]urea, with the CAS number 448895-37-2, is a chemical compound characterized by its urea functional group and two hydroxy-substituted phenyl rings, each containing a trifluoromethyl group. This structure imparts unique properties, including enhanced lipophilicity and potential biological activity. The presence of the trifluoromethyl groups contributes to its stability and can influence its interaction with biological targets, making it of interest in pharmaceutical research. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its hydroxyl groups can participate in hydrogen bonding, affecting its reactivity and interactions in various chemical environments. Additionally, due to its specific functional groups, it may exhibit properties such as antimicrobial or anti-inflammatory activity, although detailed biological evaluations would be necessary to confirm such effects. Overall, this compound represents a class of molecules that can be explored for various applications in medicinal chemistry and materials science.

Formula: C₁₅H₁₀F₆N₂O₃

InChI: InChI=1/C15H10F6N2O3/c16-14(17,18)7-1-3-11(24)9(5-7)22-13(26)23-10-6-8(15(19,20)21)2-4-12(10)25/h1-6,24-25H,(H2,22,23,26)

SMILES: c1cc(c(cc1C(F)(F)F)N=C(Nc1cc(ccc1O)C(F)(F)F)O)O

Synonyms:

• 1,3-Bis(2-Hydroxy-5-Trifluoromethylphenyl)Urea
• Urea, N,N'-bis[2-hydroxy-5-(trifluoromethyl)phenyl]-
• 1,3-Bis[2-hydroxy-5-(trifluoromethyl)phenyl]urea

NS1643

CAS: 448895-37-2

Formula: C₁₅H₁₀F₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 380.2419

Ref: IN-DA003DHE

NS1643

CAS: 448895-37-2

Formula: C₁₅H₁₀F₆N₂O₃

Molecular weight: 380.24

Ref: 7W-GL6330

NS1643

CAS: 448895-37-2

NS1643

Purity: ≥98%

Molecular weight: 380.24g/mol

Ref: 54-BUP10499

NS1643

CAS: 448895-37-2

NS1643 is a potent human ether-a-go-go related gene (hERG) KV11.1 channel activator with EC50 of 10.5 μM.

Formula: C₁₅H₁₀F₆N₂O₃

Purity: 98.37% - 99.31%

Color and Shape: Solid

Molecular weight: 380.24

Ref: TM-T3192

NS 1643

Controlled Product

CAS: 448895-37-2

Formula: C₁₅H₁₀F₆N₂O₃

Color and Shape: Neat

Molecular weight: 380.242

Ref: TR-N900220