CAS 448934-01-8

1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanamine

Description:

1-[4-(4-methyl-1,4-diazepan-1-yl)phenyl]methanamine, with the CAS number 448934-01-8, is a chemical compound characterized by its unique structure, which includes a phenyl ring substituted with a 4-methyl-1,4-diazepan-1-yl group. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which contributes to its basicity and potential reactivity. The diazepane moiety introduces a cyclic structure that can influence the compound's pharmacological properties, including its ability to interact with biological targets. The presence of the methyl group on the diazepane ring may enhance lipophilicity, affecting its solubility and permeability in biological systems. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. Overall, the characteristics of this compound, including its structural features and functional groups, make it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₃H₂₁N₃

InChI: InChI=1/C13H21N3/c1-15-7-2-8-16(10-9-15)13-5-3-12(11-14)4-6-13/h3-6H,2,7-11,14H2,1H3

SMILES: CN1CCCN(CC1)c1ccc(cc1)CN

Synonyms:

• 4-(4-Methylperhydro-1,4-Diazepin-1-Yl)Benzylamine
• 1-[4-(4-Methyl-1,4-diazepan-1-yl)phenyl]methanamine

4-(4-Methyl-1,4-diazepan-1-yl)benzylamine

CAS: 448934-01-8

Formula: C₁₃H₂₁N₃

Molecular weight: 219.3259

Ref: IN-DA00DKSG

4-(4-Methylhomopiperazin-1-yl)benzylamine

CAS: 448934-01-8

4-(4-Methylhomopiperazin-1-yl)benzylamine

Purity: 97%

Molecular weight: 219.33g/mol

Ref: 54-OR8689