CAS 4492-50-6
:N-methylcyclopentanecarboxamide
Description:
N-methylcyclopentanecarboxamide, with the CAS number 4492-50-6, is an organic compound characterized by its amide functional group attached to a cyclopentane ring. This compound features a methyl group substituent on the nitrogen atom of the amide, which influences its physical and chemical properties. Typically, N-methylcyclopentanecarboxamide is a colorless to pale yellow liquid at room temperature, exhibiting moderate solubility in polar solvents due to the presence of the amide group. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block for more complex molecules. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of other functional groups. Additionally, it may exhibit hydrogen bonding capabilities due to the amide functionality, which can affect its boiling point and solubility characteristics. Overall, N-methylcyclopentanecarboxamide is a versatile compound with notable chemical properties.
Formula:C7H13NO
InChI:InChI=1/C7H13NO/c1-8-7(9)6-4-2-3-5-6/h6H,2-5H2,1H3,(H,8,9)
SMILES:CN=C(C1CCCC1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
