CymitQuimica logo

CAS 449211-79-4

:

2H-1,2,3-Triazole, 2-[4-(chloromethyl)phenyl]-

Description:
2H-1,2,3-Triazole, 2-[4-(chloromethyl)phenyl]- is a heterocyclic compound characterized by the presence of a triazole ring, which consists of three nitrogen atoms and two carbon atoms in a five-membered ring structure. This compound features a chloromethyl group attached to a phenyl ring, enhancing its reactivity and potential for various chemical transformations. The presence of the chlorine atom can facilitate nucleophilic substitution reactions, making it useful in synthetic organic chemistry. Additionally, the triazole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals and agrochemicals. The compound may exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential applications in medicinal chemistry due to its ability to interact with biological targets. Overall, 2H-1,2,3-Triazole, 2-[4-(chloromethyl)phenyl]- represents a versatile structure with implications in both research and industrial applications.
Formula:C9H8ClN3
InChI:InChI=1S/C9H8ClN3/c10-7-8-1-3-9(4-2-8)13-11-5-6-12-13/h1-6H,7H2
InChI key:InChIKey=ISPMNMMLLQDSDT-UHFFFAOYSA-N
SMILES:C(Cl)C1=CC=C(C=C1)N2N=CC=N2
Synonyms:
  • 2-(4-Chloromethylphenyl)-2H-1,2,3-triazole
  • 2H-1,2,3-Triazole, 2-[4-(chloromethyl)phenyl]-
  • 2-(4-CHLOROMETHYL-PHENYL)-2H-[1,2,3]TRIAZOLE
  • 2-(4-Chloromethyl-phenyl)-2H-[1,2,3]triazole(WX632023)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.