CAS 4494-53-5
:2-methylisoquinoline-1,3(2H,4H)-dione
Description:
2-Methylisoquinoline-1,3(2H,4H)-dione, with the CAS number 4494-53-5, is a heterocyclic organic compound characterized by its isoquinoline structure, which includes a fused benzene and pyridine ring. This compound features a methyl group at the second position of the isoquinoline ring and two carbonyl groups at the 1 and 3 positions, contributing to its diketone nature. It is typically a yellow to orange crystalline solid, exhibiting moderate solubility in organic solvents. The presence of the diketone functionality allows for potential reactivity in various chemical transformations, including nucleophilic additions and condensation reactions. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its unique structure and properties make it a valuable compound for research in organic synthesis and the development of new materials or pharmaceuticals. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H9NO2
InChI:InChI=1/C10H9NO2/c1-11-9(12)6-7-4-2-3-5-8(7)10(11)13/h2-5H,6H2,1H3
InChI key:JNMUQWIITYQZSA-UHFFFAOYSA-N
SMILES:CN1C(=O)Cc2ccccc2C1=O
Synonyms:- 1,3(2H,4H)-isoquinolinedione, 2-methyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Methylisoquinoline-1,3(2H,4H)-dione
CAS:Formula:C10H9NO2Purity:95%Color and Shape:SolidMolecular weight:175.18402-Methyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione
CAS:2-Methyl-1,2,3,4-tetrahydroisoquinoline-1,3-dioneFormula:C10H9NO2Purity:95%Color and Shape:Solid-PowderMolecular weight:175.183962-Methylisoquinoline-1,3(2H,4H)-dione
CAS:2-Methylisoquinoline-1,3(2H,4H)-dioneFormula:C10H9NO2Purity:98+%Molecular weight:175.182-Methyl-1,3(2H,4H)-isoquinolinedione
CAS:Controlled ProductApplications 2-METHYL-1,3(2H,4H)-ISOQUINOLINEDIONE (cas# 4494-53-5) is a useful research chemical.
Formula:C10H9NO2Color and Shape:NeatMolecular weight:175.182-Methylisoquinoline-1,3(2H,4H)-dione
CAS:2-Methylisoquinoline-1,3(2H,4H)-dione is a compound with two asymmetric carbon atoms. It is a product of the monoalkylation reaction between an alkyl halide and an iminium ion. The alkyl substituents on the methyl group have a significant effect on the regioselectivity of this reaction. 2-Methylisoquinoline-1,3(2H,4H)-dione can be used to synthesize other compounds through 1,3-dipolar cycloaddition reactions or by dimerisation reactions with carbonyl substituents. This compound can also be prepared from 2-methylisoquinoline and formaldehyde in elemental form.Formula:C10H9NO2Purity:Min. 95%Molecular weight:175.18 g/mol





