CAS 4495-81-2
:2-deoxy-2-[(fluoroacetyl)amino]-D-gulose
Description:
2-Deoxy-2-[(fluoroacetyl)amino]-D-gulose is a synthetic derivative of the sugar D-gulose, characterized by the presence of a fluorinated acetylamino group at the 2-position. This compound features a hydroxyl group at the 4-position and a ketone functional group due to the acetyl moiety, which contributes to its reactivity and potential biological activity. The fluorine atom in the fluoroacetyl group can influence the compound's pharmacokinetics and interactions with biological targets, making it of interest in medicinal chemistry. The presence of the deoxy group indicates that it lacks a hydroxyl group at the 2-position, which can affect its solubility and stability compared to its parent sugar. This compound may exhibit unique properties, such as altered metabolic pathways or enhanced binding affinity to specific enzymes or receptors, making it a subject of study in biochemical and pharmaceutical research. Its CAS number, 4495-81-2, allows for easy identification and reference in scientific literature and databases.
Formula:C8H14FNO6
InChI:InChI=1/C8H14FNO6/c9-1-6(14)10-4(2-11)7(15)8(16)5(13)3-12/h2,4-5,7-8,12-13,15-16H,1,3H2,(H,10,14)/t4-,5+,7-,8-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
N-(2-Fluoroacetyl)-D-glucosamine
CAS:<p>N-(2-Fluoroacetyl)-D-glucosamine is a fluorinated derivative of D-glucosamine that has been used as a substrate in biochemical studies of glycosyltransferases. It has been found to be synthesized by lactobacillus acidophilus, which is an acidic bacterium that inhabits the human stomach and intestine. The biological properties of N-(2-fluoroacetyl)-D-glucosamine have not yet been studied in depth, but it has shown potential as a nonsteroidal anti-inflammatory drug.</p>Formula:C8H14FNO6Purity:Min. 95%Molecular weight:239.2 g/mol
