CAS 449733-84-0
:2-(4-hydroxyphenyl)ethyl 6-O-{[(2S,3E)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetyl}-beta-D-glucopyranoside
Description:
The chemical substance known as "2-(4-hydroxyphenyl)ethyl 6-O-{[(2S,3E)-3-ethylidene-2-(beta-D-glucopyranosyloxy)-5-(methoxycarbonyl)-3,4-dihydro-2H-pyran-4-yl]acetyl}-beta-D-glucopyranoside," with the CAS number 449733-84-0, is a complex glycoside. It features a phenolic moiety, which contributes to its potential antioxidant properties, and is linked to a glucopyranoside structure, indicating it has carbohydrate characteristics that may enhance its solubility and bioavailability. The presence of a methoxycarbonyl group suggests potential for reactivity and modification, while the ethylidene and dihydropyran components may impart unique stereochemical and structural properties. This compound may exhibit biological activity, possibly related to its interactions with enzymes or receptors due to its diverse functional groups. Its intricate structure suggests potential applications in pharmaceuticals or nutraceuticals, particularly in areas related to metabolic or cardiovascular health. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C31H42O17
InChI:InChI=1/C31H42O17/c1-3-16-17(18(28(41)42-2)12-45-29(16)48-31-27(40)24(37)22(35)19(11-32)46-31)10-21(34)44-13-20-23(36)25(38)26(39)30(47-20)43-9-8-14-4-6-15(33)7-5-14/h3-7,12,17,19-20,22-27,29-33,35-40H,8-11,13H2,1-2H3/b16-3+/t17?,19-,20-,22-,23-,24+,25+,26-,27-,29+,30-,31+/m1/s1
Synonyms:- Specneuzhenide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(8Z)-Nuzhenide
CAS:Nuezhenide significantly protects human neuroblastoma SH-SY5Y cells from 6-hydroxydopamine-induced neurotoxicity.Formula:C31H42O17Purity:95%~99%Color and Shape:PowderMolecular weight:686.66Specneuzhenide
CAS:Specneuzhenide is a phenol glycoside from Ligustrum sinense with anti-tumor, anti-angiogenic, and vision benefits.Formula:C31H42O17Purity:97.42% - 98%Color and Shape:SolidMolecular weight:686.66Specneuzhenide
CAS:Specneuzhenide is a secoiridoid glycoside, which is a bioactive compound derived primarily from the fruits of Ligustrum lucidum, commonly known as glossy privet. This compound is characterized by its unique structure, which includes a glycoside linkage that contributes to its biological efficacy.Formula:C31H42O17Purity:Min. 95%Molecular weight:686.65 g/mol





