CAS 449737-01-3

1-[(4'-methylbiphenyl-4-yl)oxy]propan-2-one

Description:

1-[(4'-methylbiphenyl-4-yl)oxy]propan-2-one, identified by its CAS number 449737-01-3, is an organic compound characterized by its structure, which features a propan-2-one moiety linked to a 4'-methylbiphenyl group via an ether bond. This compound typically exhibits properties common to ketones, such as being a liquid at room temperature, with a distinct odor. Its molecular structure suggests it may possess moderate polarity due to the presence of the carbonyl group, which can influence its solubility in various organic solvents. The biphenyl component may contribute to its stability and potential applications in materials science, particularly in organic electronics or as a precursor in synthetic chemistry. Additionally, the methyl group on the biphenyl ring can affect its reactivity and interaction with other chemical species. Overall, this compound's unique structural features may lend it specific functional properties that could be explored in various chemical applications.

Formula: C₁₆H₁₆O₂

InChI: InChI=1/C16H16O2/c1-12-3-5-14(6-4-12)15-7-9-16(10-8-15)18-11-13(2)17/h3-10H,11H2,1-2H3

SMILES: Cc1ccc(cc1)c1ccc(cc1)OCC(=O)C

Synonyms:

• 1-[(4'-Methylbiphenyl-4-yl)oxy]acetone
• 2-Propanone, 1-[(4'-Methyl[1,1'-Biphenyl]-4-Yl)Oxy]-

1-[(4′-methylbiphenyl-4-yl)oxy]acetone

CAS: 449737-01-3

Formula: C₁₆H₁₆O₂

Purity: 95.0%

Molecular weight: 240.302

Ref: 10-F315265