CAS 449756-97-2
:Benzenemethanamine,2-(1H-1,2,4-triazol-1-yl)-
Description:
Benzenemethanamine, 2-(1H-1,2,4-triazol-1-yl)-, also known by its CAS number 449756-97-2, is an organic compound characterized by the presence of both a benzene ring and a triazole moiety. This compound features an amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions. The triazole ring, a five-membered heterocyclic structure containing three nitrogen atoms, imparts unique properties such as increased stability and the ability to participate in coordination chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of both aromatic and heterocyclic components may influence its biological activity, making it a subject of interest in medicinal chemistry research. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C9H10N4
InChI:InChI=1/C9H10N4/c10-5-8-3-1-2-4-9(8)13-7-11-6-12-13/h1-4,6-7H,5,10H2
SMILES:c1ccc(c(c1)CN)n1cncn1
Synonyms:- 1-[2-(1H-1,2,4-Triazol-1-yl)phenyl]methanamin
- 1-[2-(1H-1,2,4-triazol-1-yl)phenyl]methanamine
- 2-(1H-1,2,4-Triazol-1-Yl)Benzenemethanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2-(1H-1,2,4-Triazol-1-yl)phenyl)methanamine
CAS:Formula:C9H10N4Color and Shape:SolidMolecular weight:174.20252-(1H-1,2,4-Triazol-1-yl)benzenemethanamine
CAS:2-(1H-1,2,4-Triazol-1-yl)benzenemethanamine
Purity:95%Molecular weight:174.20g/mol2-[1,2,4]Triazol-1-yl-benzylamine
CAS:2-[1,2,4]Triazol-1-yl-benzylamine is a chemical compound that has been shown to be an excellent reagent in organic synthesis. It is also used as a building block for the synthesis of compounds related to pharmaceuticals, pesticides and other speciality chemicals. 2-[1,2,4]Triazol-1-yl-benzylamine is a versatile intermediate that can be used in the synthesis of complex compounds with good yields and high purity.
Formula:C9H10N4Purity:Min. 95%Color and Shape:PowderMolecular weight:174.2 g/mol


