CymitQuimica logo

CAS 449758-77-4

:

2-Methyl-1,2-azetidinedicarboxylic acid 1-(1,1-dimethylethyl) ester

Description:
2-Methyl-1,2-azetidinedicarboxylic acid 1-(1,1-dimethylethyl) ester is a chemical compound characterized by its unique structure, which includes an azetidine ring and two carboxylic acid functional groups. This compound is an ester, indicating that it is formed from the reaction of an alcohol (in this case, 1-(1,1-dimethylethyl) alcohol) with a dicarboxylic acid. The presence of the methyl group on the azetidine ring contributes to its steric properties, potentially influencing its reactivity and interactions with other molecules. The tert-butyl group (1-(1,1-dimethylethyl)) enhances the lipophilicity of the compound, which may affect its solubility in organic solvents and its behavior in biological systems. This compound may have applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex molecules. However, specific data regarding its physical properties, such as boiling point, melting point, and solubility, would require further investigation or experimental determination.
Formula:C10H17NO4
InChI:InChI=1S/C10H17NO4/c1-9(2,3)15-8(14)11-6-5-10(11,4)7(12)13/h5-6H2,1-4H3,(H,12,13)
InChI key:HFEGSFBKYUXELG-UHFFFAOYSA-N
SMILES:CC1(CCN1C(=O)OC(C)(C)C)C(=O)O
Synonyms:
  • 1-[(Tert-Butoxy)Carbonyl]-2-Methylazetidine-2-Carboxylic Acid
Found 4 products.