
CAS 44976-95-6
:3-Bromo-2-(phosphonooxy)-2-propenoic acid
Description:
3-Bromo-2-(phosphonooxy)-2-propenoic acid, with the CAS number 44976-95-6, is an organophosphorus compound characterized by the presence of a bromine atom and a phosphonooxy functional group attached to a propenoic acid backbone. This compound typically exhibits properties associated with both organic acids and phosphonates, including potential acidity due to the carboxylic acid group and reactivity stemming from the phosphonooxy moiety. It is likely to be soluble in polar solvents, given the presence of the phosphono group, and may participate in various chemical reactions, such as nucleophilic substitutions or esterifications. The bromine substituent can influence its reactivity and stability, potentially making it a useful intermediate in organic synthesis or as a biochemical agent. Additionally, compounds of this nature may have applications in agriculture, particularly as herbicides or plant growth regulators, due to their ability to interact with biological systems. However, specific safety and handling guidelines should be followed, as organophosphorus compounds can exhibit toxicity.
Formula:C3H4BrO6P
InChI:InChI=1S/C3H4BrO6P/c4-1-2(3(5)6)10-11(7,8)9/h1H,(H,5,6)(H2,7,8,9)
InChI key:InChIKey=VBGFKOJASDELJL-UHFFFAOYSA-N
SMILES:C(OP(=O)(O)O)(C(O)=O)=CBr
Synonyms:- 3-Bromo-2-(phosphonooxy)-2-propenoic acid
- Phosphoenol-3-bromopyruvic acid
- 2-Propenoic acid, 3-bromo-2-(phosphonooxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphoenol-3-bromopyruvate
CAS:<p>Phosphoenol-3-bromopyruvate is a mechanism-based inhibitor of phosphoenolpyruvate carboxylase from maize</p>Formula:C3H4BrO6PColor and Shape:SolidMolecular weight:246.94
