CAS 4498-72-0
:1-(1H-indazol-3-yl)ethanone
Description:
1-(1H-indazol-3-yl)ethanone, with the CAS number 4498-72-0, is an organic compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethanone functional group, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The indazole moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. Typically, compounds like this may exhibit various properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The compound's structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Overall, 1-(1H-indazol-3-yl)ethanone is a compound of interest due to its structural features and potential applications in drug discovery.
Formula:C9H8N2O
InChI:InChI=1/C9H8N2O/c1-6(12)9-7-4-2-3-5-8(7)10-11-9/h2-5H,1H3,(H,10,11)
SMILES:CC(=O)c1c2ccccc2[nH]n1
Synonyms:- Ethanone, 1-(1H-indazol-3-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(1H-Indazol-3-yl)ethanone
CAS:Formula:C9H8N2OPurity:97%Color and Shape:SolidMolecular weight:160.17261-(1H-Indazol-3-yl)ethanone
CAS:Controlled Product1-(1H-Indazol-3-yl)ethanone is a drug that belongs to the class of c6 alkyl ionizable. It has been shown to have an inhibitory effect on the enzyme thiomorpholine, which is involved in the biosynthesis of the neurotransmitter acetylcholine and other important biochemicals. 1-(1H-Indazol-3-yl)ethanone is used in clinical medication for autoimmune diseases, inflammatory diseases, cancer, and morpholine. It is also used as a research chemical for studying cancer and morpholine.
Formula:C9H8N2OPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:160.17 g/molRef: 3D-FI142886
Discontinued product



