CymitQuimica logo

CAS 450-39-5

:

1,1'-Biphenyl, 4-fluoro-4'-methoxy-

Description:
1,1'-Biphenyl, 4-fluoro-4'-methoxy- is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position of one phenyl ring and a methoxy group (-OCH3) at the para position of the other ring significantly influences its chemical properties. This compound is typically a colorless to pale yellow solid at room temperature and is known for its moderate solubility in organic solvents. It exhibits interesting electronic properties due to the electron-withdrawing nature of the fluorine atom and the electron-donating characteristics of the methoxy group, which can affect its reactivity and interactions in various chemical reactions. Additionally, 1,1'-Biphenyl, 4-fluoro-4'-methoxy- may be utilized in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H11FO
InChI:InChI=1S/C13H11FO/c1-15-13-8-4-11(5-9-13)10-2-6-12(14)7-3-10/h2-9H,1H3
InChI key:HPHJIGXCDCZLTP-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2=CC=C(C=C2)F
Found 6 products.