CAS 450-84-0
:4-Fluoro-2-methoxy-1-nitrosobenzene
Description:
4-Fluoro-2-methoxy-1-nitrosobenzene, with the CAS number 450-84-0, is an organic compound characterized by the presence of a nitroso group (-NO) attached to a benzene ring that also features a fluorine atom and a methoxy group (-OCH3) as substituents. This compound typically exhibits a pale yellow to orange color and is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the nitroso group can impart unique reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. The fluorine atom enhances the compound's electronic properties, potentially influencing its reactivity and stability. Additionally, the methoxy group can affect solubility and polarity, making the compound more versatile in different chemical environments. Safety considerations should be taken into account when handling this compound, as nitroso compounds can be hazardous and may pose health risks. Proper storage and handling protocols are essential to ensure safety in laboratory settings.
Formula:C7H6FNO2
InChI:InChI=1S/C7H6FNO2/c1-11-7-4-5(8)2-3-6(7)9-10/h2-4H,1H3
InChI key:InChIKey=KJRMOZIMBHAXSG-UHFFFAOYSA-N
SMILES:N(=O)C1=C(OC)C=C(F)C=C1
Synonyms:- Benzene, 4-fluoro-2-methoxy-1-nitroso-
- Anisole, 3-fluoro-6-nitroso-
- 4-Fluoro-2-methoxy-1-nitrosobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
