CAS 4500-20-3

N-hydroxy-4-phenylcyclohexanimine

Description:

N-hydroxy-4-phenylcyclohexanimine, with the CAS number 4500-20-3, is an organic compound characterized by the presence of a hydroxylamine functional group attached to a cyclohexane ring that is further substituted with a phenyl group. This compound typically exhibits properties associated with both hydroxylamines and amines, such as being a potential nucleophile due to the presence of the nitrogen atom. It may participate in various chemical reactions, including oxidation and condensation reactions, making it useful in synthetic organic chemistry. The presence of the phenyl group can influence its solubility and reactivity, often rendering it more lipophilic. Additionally, N-hydroxy-4-phenylcyclohexanimine may exhibit biological activity, which could be of interest in medicinal chemistry. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₁₂H₁₅NO

InChI: InChI=1/C12H15NO/c14-13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-5,11,14H,6-9H2/b13-12-

Synonyms:

• 4-Phenylcyclohexanone oxime

4-Phenylcyclohexane-1-oneoxime

CAS: 4500-20-3

Formula: C₁₂H₁₅NO

Purity: %

Color and Shape: Solid

Molecular weight: 189.2536

Ref: IN-DA00DZPH

4-Phenylcyclohexanone oxime

CAS: 4500-20-3

4-Phenylcyclohexanone oxime

Purity: 95%

Molecular weight: 189.26g/mol

Ref: 54-OR1067010

4-phenylcyclohexanone oxime

CAS: 4500-20-3

Formula: C₁₂H₁₅NO

Purity: 95+%

Molecular weight: 189.258

Ref: 10-F371099