CAS 450368-34-0

1,2,3,4-Tetrahydro-1-methyl-3-oxo-6-quinoxalinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-1-methyl-3-oxo-6-quinoxalinecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a quinoxaline moiety. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of a methyl group and a keto group (3-oxo) further influences its chemical properties, including its solubility and potential interactions with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for various potential applications, including as a building block in organic synthesis or as a lead compound in drug development. The CAS number 450368-34-0 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound suggest it may have significant implications in research and development within the fields of chemistry and biochemistry.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-12-5-9(13)11-7-4-6(10(14)15)2-3-8(7)12/h2-4H,5H2,1H3,(H,11,13)(H,14,15)

InChI key: InChIKey=ZQAREAJRBFNQEW-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC(C(O)=O)=CC2)NC(=O)C1

Synonyms:

• 6-Quinoxalinecarboxylic acid, 1,2,3,4-tetrahydro-1-methyl-3-oxo-
• 1,2,3,4-Tetrahydro-1-methyl-3-oxo-6-quinoxalinecarboxylic acid
• 1-Methyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid

1-methyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic Acid (85%)

Controlled Product

CAS: 450368-34-0

Applications 1-methyl-3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid (cas# 450368-34-0) is a useful research chemical.

Formula: C₁₀H₁₀N₂O₃

Purity: 85%

Color and Shape: Neat

Molecular weight: 206.19

Ref: TR-B499110