CAS 4504-43-2

2-(phenylamino)cyclohexanone

Description:

2-(Phenylamino)cyclohexanone, with the CAS number 4504-43-2, is an organic compound characterized by its cyclohexanone structure substituted with a phenylamino group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the phenylamino group contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The compound may exhibit specific physical properties, including a distinct melting point and solubility characteristics, which can vary based on the solvent used. Additionally, 2-(phenylamino)cyclohexanone may display biological activity, making it of interest in pharmacological research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, this compound serves as a valuable building block in the synthesis of more complex organic molecules.

Formula: C₁₂H₁₅NO

InChI: InChI=1/C12H15NO/c14-12-9-5-4-8-11(12)13-10-6-2-1-3-7-10/h1-3,6-7,11,13H,4-5,8-9H2

SMILES: c1ccc(cc1)NC1CCCCC1=O

Synonyms:

• 2-(Phenylamino)cyclohexanon
• Cyclohexanone, 2-(Phenylamino)-

2-anilinocyclohexanone

CAS: 4504-43-2

Formula: C₁₂H₁₅NO

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 189.258

Ref: 10-F313830