CAS 4506-45-0

5-chloro-2-formylbenzoic acid

Description:

5-Chloro-2-formylbenzoic acid is an aromatic compound characterized by the presence of a chloro substituent and a formyl group on a benzoic acid framework. Its molecular structure features a benzene ring with a carboxylic acid group (-COOH) and an aldehyde group (-CHO) at the 2 and 5 positions, respectively. This compound is typically a white to off-white solid and is soluble in polar organic solvents. It exhibits properties typical of both carboxylic acids and aldehydes, including the ability to participate in various chemical reactions such as condensation and oxidation. The presence of the chlorine atom can influence its reactivity and polarity, making it a useful intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling, as with many chlorinated compounds, it may pose health risks if not managed properly.

Formula: C₈H₅ClO₃

InChI: InChI=1/C8H5ClO3/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-4H,(H,11,12)

SMILES: c1cc(cc(c1C=O)C(=O)O)Cl

Synonyms:

• Benzoic acid, 5-chloro-2-formyl-

5-Chloro-2-formyl-benzoic acid

CAS: 4506-45-0

Formula: C₈H₅ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.5765

Ref: IN-DA00DBUI

5-Chloro-2-formylbenzoic acid

CAS: 4506-45-0

5-Chloro-2-formylbenzoic acid

Purity: 97%

Molecular weight: 184.58g/mol

Ref: 54-OR313090

5-Chloro-2-formyl-benzoic acid

CAS: 4506-45-0

Formula: C₈H₅ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 184.58

Ref: 10-F031122