CAS 4507-57-7
:Methyl-1-aminocyclohexane carboxylat
Description:
Methyl-1-aminocyclohexane carboxylate, with the CAS number 4507-57-7, is an organic compound characterized by its cyclohexane structure, which features a carboxylate group and an amino group. This compound typically exhibits properties associated with both amines and esters, including potential basicity due to the amino group and reactivity due to the carboxylate moiety. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility in polar solvents such as water and alcohols. Additionally, Methyl-1-aminocyclohexane carboxylate may be used in various chemical syntheses or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as compounds with amine functionalities can exhibit varying degrees of toxicity and reactivity. Overall, this compound represents a versatile building block in organic chemistry.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-11-7(10)8(9)5-3-2-4-6-8/h2-6,9H2,1H3
SMILES:COC(=O)C1(CCCCC1)N
Synonyms:- Methyl-1-aminocyclohexane carboxylate
- Methyl-1-aminocyclohexane carboxylate (free base)
- Methyl1-Aminocyclohexanecarboxylate
- Methyl 1-Aminocyclohexanate
- Methyl 1-Aminocyclohexanecarboxylate
- Methyl 1-Aminocyclohexane-1-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 1-aminocyclohexanecarboxylate
CAS:Formula:C8H15NO2Purity:97%Color and Shape:LiquidMolecular weight:157.2102Methyl 1-aminocyclohexanoate
CAS:<p>Methyl 1-aminocyclohexanoate</p>Purity:97%Molecular weight:157.21g/molMethyl 1-aminocyclohexanecarboxylate
CAS:Formula:C8H15NO2Purity:95%Color and Shape:LiquidMolecular weight:157.213Methyl 1-aminocyclohexanecarboxylate hydrochloride
CAS:Please enquire for more information about Methyl 1-aminocyclohexanecarboxylate hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H15NO2Purity:Min. 95%Molecular weight:157.21 g/mol



