CAS 450839-40-4

6-[(2S)-2-(4-cyanophenyl)-2-hydroxy-2-(1-methyl-1H-imidazol-5-yl)ethoxy]-4'-(trifluoromethoxy)biphenyl-3-carbonitrile

Description:

The chemical substance known as "6-[(2S)-2-(4-cyanophenyl)-2-hydroxy-2-(1-methyl-1H-imidazol-5-yl)ethoxy]-4'-(trifluoromethoxy)biphenyl-3-carbonitrile," with the CAS number 450839-40-4, is a complex organic compound characterized by its biphenyl structure, which is substituted with various functional groups. This compound features a trifluoromethoxy group, which enhances its lipophilicity and may influence its biological activity. The presence of a hydroxyl group and a cyanophenyl moiety suggests potential interactions in biological systems, possibly indicating its role as a pharmaceutical agent or a research chemical. The imidazole ring contributes to its potential as a ligand in coordination chemistry or as a pharmacophore in medicinal chemistry. Overall, the structural complexity and the presence of multiple functional groups suggest that this compound may exhibit interesting chemical properties and biological activities, making it a subject of interest in various fields, including drug discovery and materials science.

Formula: C₂₇H₁₉F₃N₄O₃

InChI: InChI=1/C27H19F3N4O3/c1-34-17-33-15-25(34)26(35,21-7-2-18(13-31)3-8-21)16-36-24-11-4-19(14-32)12-23(24)20-5-9-22(10-6-20)37-27(28,29)30/h2-12,15,17,35H,16H2,1H3/t26-/m0/s1

SMILES: Cn1cncc1[C@](COc1ccc(cc1c1ccc(cc1)OC(F)(F)F)C#N)(c1ccc(cc1)C#N)O

ABT-100

CAS: 450839-40-4

ABT-100 is a potent, highly selective, and orally active farnesyl transferase inhibitor with broad-spectrum antitumor activity.

Formula: C₂₇H₁₉F₃N₄O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 504.46

Ref: TM-T10223