CAS 451-82-1: (2-Fluorophenyl)acetic acid
Description:(2-Fluorophenyl)acetic acid, with the CAS number 451-82-1, is an aromatic carboxylic acid characterized by the presence of a fluorine atom on the phenyl ring. This compound features a two-carbon acetic acid chain attached to a phenyl group, which is substituted at the ortho position with a fluorine atom. The presence of the fluorine atom can influence the compound's reactivity, polarity, and biological activity. Typically, (2-Fluorophenyl)acetic acid is a white to off-white solid at room temperature, and it is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic aromatic structure. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in drug development and as an intermediate in organic synthesis. Its chemical properties, such as acidity and reactivity, can be influenced by the electron-withdrawing nature of the fluorine substituent, which can affect the compound's behavior in chemical reactions and interactions with biological systems.
Formula:C8H7FO2
InChI:InChI=1S/C8H7FO2/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4H,5H2,(H,10,11)
InChI key:InChIKey=RPTRFSADOICSSK-UHFFFAOYSA-N
SMILES:O=C(O)CC=1C=CC=CC1F
- Synonyms:
- (2-Fluorophenyl)Acetate
- (o-Fluorophenyl)acetic acid
- 2-(2-Fluorophenyl)acetic acid
- 2-(2-Fluorophenyl)ethanoic acid hydrochloride
- 2-Fluorobenzeneacetic acid
- 2-Fluorophenyl Acetic Acid
- Acetic acid, (o-fluorophenyl)-
- Benzeneacetic acid, 2-fluoro-
- NSC 401
- O-Flurophenylacetic Acid
- See more synonyms
- o-Fluorobenzeneacetic acid
- o-Fluorophenylacetic acid
