CAS 45127-11-5
:Coenzyme M
Description:
Coenzyme M, also known as 2-mercaptoethanesulfonic acid, is a crucial cofactor in various biochemical processes, particularly in the metabolism of certain microorganisms. It plays a significant role in the methanogenic pathway, where it acts as a carrier of methyl groups. Coenzyme M is characterized by its sulfonic acid functional group, which contributes to its solubility in water and its ability to participate in redox reactions. The compound is typically found in a zwitterionic form at physiological pH, possessing both positive and negative charges. This unique structure allows it to interact effectively with enzymes involved in methanogenesis. Coenzyme M is also notable for its stability under a range of environmental conditions, making it a vital component in anaerobic digestion processes. Its presence is essential for the activity of methyl-coenzyme M reductase, an enzyme that catalyzes the final step in methane production. Overall, Coenzyme M is integral to energy metabolism in certain anaerobic microorganisms, highlighting its importance in both ecological and biotechnological contexts.
Formula:C4H10O6S4
InChI:InChI=1/C4H10O6S4/c5-13(6,7)3-1-11-12-2-4-14(8,9)10/h1-4H2,(H,5,6,7)(H,8,9,10)
SMILES:C(CS(=O)(=O)O)SSCCS(=O)(=O)O
Synonyms:- 2,2'-Dithiodiethanesulfonic acid
- 2,2'-Dithidi-1-ethanesulfonic acid
- Bis(2-sulfoethyl)disulfide
- omega,omega'-Ethanedisulfidedisulfonic acid
- Ethanesulfonic acid, 2,2'-dithiobis-
- 2,2'-Disulfanediyldiethanesulfonic Acid
- (2,2-(Disulfane Diyl)Bis(Ethanesulphonic Acid)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2'-Disulfanediyldiethanesulfonic acid
CAS:2,2'-Disulfanediyldiethanesulfonic acidPurity:95%Molecular weight:282.39g/mol2-[(2-Sulfoethyl)disulfanyl]ethane-1-sulfonic acid
CAS:<p>Please enquire for more information about 2-[(2-Sulfoethyl)disulfanyl]ethane-1-sulfonic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C4H10O6S4Purity:Min. 95%Molecular weight:282.4 g/molDimesna free acid
CAS:<p>Dimesna (BNP-778), when used in conjunction with active cancer chemotherapy agents, can reduce the toxicity associated with uremia.</p>Formula:C4H10O6S4Color and Shape:SolidMolecular weight:282.38






