CymitQuimica logo

CAS 451485-70-4

:

2-(4-Chloro-3-fluorophenoxy)benzaldehyde oxime

Description:
2-(4-Chloro-3-fluorophenoxy)benzaldehyde oxime, with the CAS number 451485-70-4, is an organic compound characterized by its oxime functional group, which is derived from the corresponding aldehyde. This compound features a phenoxy group attached to a benzaldehyde moiety, with chlorine and fluorine substituents on the aromatic rings, contributing to its unique chemical properties. The presence of these halogen atoms can influence the compound's reactivity, polarity, and potential biological activity. Typically, compounds like this may exhibit moderate to high solubility in organic solvents, while their solubility in water can vary based on the substituents and overall molecular structure. The oxime functional group can participate in various chemical reactions, including condensation and rearrangement, making it a versatile intermediate in organic synthesis. Additionally, the compound may possess specific applications in pharmaceuticals or agrochemicals, where the halogen substituents can enhance biological activity or selectivity. Overall, 2-(4-Chloro-3-fluorophenoxy)benzaldehyde oxime is a compound of interest in both synthetic chemistry and potential applications in various fields.
Formula:C13H9ClFNO2
InChI:InChI=1S/C13H9ClFNO2/c14-11-6-5-10(7-12(11)15)18-13-4-2-1-3-9(13)8-16-17/h1-8,17H
InChI key:InChIKey=VGQLDYWJGIQJRP-UHFFFAOYSA-N
SMILES:O(C1=C(C=NO)C=CC=C1)C2=CC(F)=C(Cl)C=C2
Synonyms:
  • 2-(4-Chloro-3-fluorophenoxy)benzaldehyde oxime
  • Benzaldehyde, 2-(4-chloro-3-fluorophenoxy)-, oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.