CAS 45164-27-0
:2-Oxa-6,9-diaza-1-phosphaundecan-11-ol, 1,1-dihydroxy-, 1-oxide
Description:
2-Oxa-6,9-diaza-1-phosphaundecan-11-ol, 1,1-dihydroxy-, 1-oxide, with the CAS number 45164-27-0, is a chemical compound that features a unique structure incorporating both phosphorus and nitrogen atoms, along with oxygen functionalities. This compound is characterized by the presence of a phosphine oxide group, which contributes to its reactivity and potential applications in various fields, including organic synthesis and coordination chemistry. The presence of multiple nitrogen atoms suggests that it may exhibit interesting coordination properties with metal ions, making it a candidate for use in catalysis or as a ligand in coordination complexes. Additionally, the hydroxyl groups in its structure can enhance solubility in polar solvents and may participate in hydrogen bonding interactions. Overall, this compound's distinctive features, including its heteroatom composition and functional groups, make it a subject of interest for further research in both theoretical and applied chemistry contexts.
Formula:C7H19N2O5P
InChI:InChI=1S/C7H19N2O5P/c10-6-5-9-4-3-8-2-1-7-14-15(11,12)13/h8-10H,1-7H2,(H2,11,12,13)
InChI key:InChIKey=NAVOCVSWUIVXAQ-UHFFFAOYSA-N
SMILES:C(CNCCNCCO)COP(=O)(O)O
Synonyms:- 2-Oxa-6,9-diaza-1-phosphaundecan-11-ol, 1,1-dihydroxy-, 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cyclophosphamide Impurity 3 DiHCl
CAS:Formula:C7H19N2O5P·2HClColor and Shape:Pale Brown OilMolecular weight:242.21 2*36.469-Hydroxy-4,7-diaza-nonyl Phosphate
CAS:Controlled ProductFormula:C7H19N2O5PColor and Shape:NeatMolecular weight:242.21

