CAS 4519-28-2
:Phosphonium, tetramethyl-, bromide
Description:
Tetramethylphosphonium bromide (TMPB) is a quaternary ammonium salt characterized by its phosphonium cation, which consists of a phosphorus atom bonded to four methyl groups and a bromide anion. This compound is typically a white crystalline solid that is soluble in polar solvents such as water and alcohols, making it useful in various chemical applications. TMPB is known for its role as a phase transfer catalyst, facilitating the transfer of ions or molecules between immiscible phases, which is particularly valuable in organic synthesis. Additionally, it can serve as a source of the tetramethylphosphonium ion in various reactions, including nucleophilic substitutions. The compound is relatively stable under standard conditions but should be handled with care due to its potential toxicity and irritant properties. Its applications extend to fields such as organic chemistry, materials science, and biochemistry, where it aids in enhancing reaction efficiencies and yields.
Formula:C4H12P·Br
InChI:InChI=1S/C4H12P.BrH/c1-5(2,3)4;/h1-4H3;1H/q+1;/p-1
InChI key:InChIKey=ZTXFOCMYRCGSMU-UHFFFAOYSA-M
SMILES:[P+](C)(C)(C)C.[Br-]
Synonyms:- Phosphonium, tetramethyl-, bromide
- Tetramethylphosphonium bromide
- NSC 617067
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tetramethylphosphonium bromide, 97%
CAS:It is used as a pharmaceutical intermediate and in chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU ref
Formula:C4H12BrPPurity:97%Color and Shape:White to pale yellow or pale pink-purple, Crystals or powder or crystalline powder or fused/lumpy solidMolecular weight:171.02Tetramethylphosphonium bromide
CAS:Formula:C4H12BrPPurity:98%Color and Shape:SolidMolecular weight:171.0158Tetramethylphosphonium Bromide
CAS:Tetramethylphosphonium BromidePurity:98%Molecular weight:171.02g/molTetramethylphosphonium Bromide
CAS:Controlled ProductApplications Tetramethylphosphonium Bromide (cas# 4519-28-2) is a useful research chemical.
Formula:C4H12P·BrColor and Shape:NeatMolecular weight:171.016



