CAS 452-67-5
:1,4-Difluoro-2-methylbenzene
Description:
1,4-Difluoro-2-methylbenzene, also known as p-difluorotoluene, is an aromatic compound characterized by a benzene ring substituted with two fluorine atoms at the 1 and 4 positions and a methyl group at the 2 position. Its molecular formula is C7H6F2, and it features a distinct structure that influences its chemical properties. This compound is typically a colorless liquid with a characteristic aromatic odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical applications, including as a solvent or intermediate in organic synthesis. The presence of fluorine atoms enhances its reactivity and stability, allowing it to participate in electrophilic substitution reactions. Additionally, 1,4-difluoro-2-methylbenzene is of interest in materials science and pharmaceuticals due to its unique electronic properties. However, like many fluorinated compounds, it should be handled with care due to potential environmental and health impacts.
Formula:C7H6F2
InChI:InChI=1S/C7H6F2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3
InChI key:InChIKey=YSNVKDGEALPJGC-UHFFFAOYSA-N
SMILES:CC1=C(F)C=CC(F)=C1
Synonyms:- 1,4-Difluoro-2-methylbenzene
- 1-Fluoro-4-Iodo-2-Methylbenzene
- Ai3-52231
- Benzene, 1,4-difluoro-2-methyl-
- NSC 25757
- Toluene, 2,5-difluoro-
- 2,5-Difluorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,5-Difluorotoluene
CAS:2,5-DifluorotolueneFormula:C7H6F2Purity:98%Color and Shape: clear. colourless liquidMolecular weight:128.12g/mol2,5-Difluorotoluene
CAS:2,5-Difluorotoluene is an organic compound that belongs to the class of polyethers. It is a colorless liquid with a mild, sweet odor. The benzyl group and methyl groups in this compound give it special physical properties, such as the ability to dissolve in organic solvents. The phenyl rings are arranged in a symmetrical pattern that makes the molecule chiral. This means that 2,5-difluorotoluene has two different chemical forms: one form is levorotatory (rotates polarized light to the left) and one form is dextrorotatory (rotates polarized light to the right). These two forms are called enantiomers. The differences in their physical properties can be seen when they are dissolved in polar solvents or nonpolar solvents. 2,5-Difluorotoluene is used as an intermediate for making other chemicals.Formula:C7H6F2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:128.12 g/mol



