CymitQuimica logo

CAS 452077-13-3

:

di-tert-butyl (2-aminophenyl)imidodicarbonate

Description:
Di-tert-butyl (2-aminophenyl)imidodicarbonate is a chemical compound characterized by its unique structure, which includes a central imidodicarbonate group bonded to a 2-aminophenyl moiety and two tert-butyl groups. This compound typically appears as a solid at room temperature and is known for its stability under standard conditions. It is often utilized in organic synthesis, particularly in the formation of carbamates and as a protecting group for amines due to its ability to selectively react with nucleophiles. The presence of the tert-butyl groups enhances its steric hindrance, making it less reactive towards certain electrophiles, while the amino group can participate in hydrogen bonding and other interactions. Additionally, di-tert-butyl (2-aminophenyl)imidodicarbonate may exhibit solubility in organic solvents, which is advantageous for various synthetic applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H24N2O4
InChI:InChI=1/C16H24N2O4/c1-15(2,3)21-13(19)18(14(20)22-16(4,5)6)12-10-8-7-9-11(12)17/h7-10H,17H2,1-6H3
SMILES:CC(C)(C)OC(=O)N(c1ccccc1N)C(=O)OC(C)(C)C
Synonyms:
  • Di-tert-butyl (2-aminophenyl)imidodicarbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.