CAS 4524-93-0
:Cyclopentanecarbonyl chloride
Description:
Cyclopentanecarbonyl chloride, with the CAS number 4524-93-0, is an organic compound characterized by the presence of a cyclopentane ring attached to a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis. Cyclopentanecarbonyl chloride can participate in various chemical reactions, including nucleophilic acyl substitution, where it can react with nucleophiles such as alcohols or amines to form esters or amides, respectively. It is important to handle this compound with care, as it can be corrosive and may release hydrochloric acid upon hydrolysis. Additionally, it is typically stored under inert conditions to prevent moisture absorption, which can lead to degradation. Overall, cyclopentanecarbonyl chloride serves as a valuable reagent in the synthesis of more complex organic molecules.
Formula:C6H9ClO
InChI:InChI=1S/C6H9ClO/c7-6(8)5-3-1-2-4-5/h5H,1-4H2
InChI key:InChIKey=WEPUZBYKXNKSDH-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1CCCC1
Synonyms:- 1-Cyclopentanecarbonyl chloride
- Cyclopenanecarbonyl chloride
- Cyclopentane carboxyl chloride
- Cyclopentanecarbonylchloride
- Cyclopentanecarboxylic Acid Chloride
- Cyclopentanoyl chloride
- Cyclopentylcarbonyl chloride
- Cyclopetanecarbonylchloride
- Cyclopentanecarbonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cyclopentanecarbonyl Chloride
CAS:Formula:C6H9ClOPurity:>98.0%(GC)(T)Color and Shape:Colorless to Light orange to Yellow clear liquidMolecular weight:132.59Cyclopentanecarbonyl chloride, 98%
CAS:Cyclopentanecarbonyl chloride is used in biochemical for proteomics research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or
Formula:C6H9ClOPurity:98%Color and Shape:Clear colorless to pale yellow, LiquidMolecular weight:132.59Cyclopentanecarbonyl chloride
CAS:Formula:C6H9ClOPurity:98%Color and Shape:LiquidMolecular weight:132.5881Cyclopentanecarbonyl chloride
CAS:Cyclopentanecarbonyl chlorideFormula:C6H9ClOPurity:94%Color and Shape: clear. brown to beige liquidMolecular weight:132.58805g/molCyclopentanecarbonyl chloride
CAS:Formula:C6H9ClOPurity:98%Color and Shape:ClearMolecular weight:132.59Cyclopentanecarbonyl Chloride
CAS:Controlled ProductFormula:C6H9ClOColor and Shape:NeatMolecular weight:132.59





