CymitQuimica logo

CAS 4527-49-5

:

4-nonylbenzenethiol

Description:
4-Nonylbenzenethiol, with the CAS number 4527-49-5, is an organic compound characterized by a nonyl group attached to a benzene ring, which is further substituted with a thiol (-SH) functional group. This compound typically appears as a viscous liquid and is known for its distinctive odor. It is hydrophobic due to the long nonyl chain, which enhances its solubility in organic solvents while making it less soluble in water. The presence of the thiol group imparts unique chemical reactivity, allowing it to participate in various chemical reactions, such as oxidation and nucleophilic substitution. 4-Nonylbenzenethiol is often utilized in the synthesis of surfactants, antioxidants, and as a coupling agent in polymer chemistry. Additionally, its properties make it valuable in the formulation of specialty chemicals and materials. Safety considerations include handling it with care due to potential irritant effects and the need for proper ventilation during use.
Formula:C15H24S
InChI:InChI=1/C15H24S/c1-2-3-4-5-6-7-8-9-14-10-12-15(16)13-11-14/h10-13,16H,2-9H2,1H3
SMILES:CCCCCCCCCc1ccc(cc1)S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 4-Nonylbenzenethiol

    Controlled Product
    CAS:
    Formula:C15H24S
    Color and Shape:Neat
    Molecular weight:236.416

    Ref: TR-N257620

    25mg
    2,058.00€