CAS 4527-60-0
:N-(2-bromophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide
Description:
N-(2-bromophenyl)-2-(5-methylthiophen-2-yl)quinoline-4-carboxamide, with the CAS number 4527-60-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline core substituted with a carboxamide group and various aromatic rings. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the bromine atom and the methylthio group can influence its reactivity and solubility, making it of interest in medicinal chemistry and material science. It may demonstrate specific interactions with biological targets, which could be explored for therapeutic applications. Additionally, its unique structure may impart distinct optical or electronic properties, making it suitable for research in organic electronics or photonics. As with many organic compounds, its behavior in different solvents and under various conditions can significantly affect its applications and efficacy in practical uses.
Formula:C21H15BrN2OS
InChI:InChI=1/C21H15BrN2OS/c1-13-10-11-20(26-13)19-12-15(14-6-2-4-8-17(14)23-19)21(25)24-18-9-5-3-7-16(18)22/h2-12H,1H3,(H,24,25)
SMILES:Cc1ccc(c2cc(c3ccccc3n2)C(=Nc2ccccc2Br)O)s1
Synonyms:- 4-quinolinecarboxamide, N-(2-bromophenyl)-2-(5-methyl-2-thienyl)-
- N-(2-Bromophenyl)-2-(5-methyl-2-thienyl)quinoline-4-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-Methylnaphthalene-1-carboxylic acid
CAS:5-Methylnaphthalene-1-carboxylic acid is a synthetic compound that has been shown to increase the effects of adriamycin, which is an anticancer drug. It has also been shown to have anti-inflammatory and anti-tumor properties. The 5-methylnaphthalene ring in 5-methylnaphthalene-1-carboxylic acid is very rigid and lacks conformational freedom, which may account for its low activity against bacteria. The methyl group in this molecule could be transferred to other molecules as a methyl group donor, making it a potential precursor for synthesis of antibiotics.
Formula:C12H10O2Purity:Min. 95%Molecular weight:186.21 g/mol


