CAS 4528-52-3
:N-methyl-N-[(2S)-1-phenylpropan-2-yl]prop-2-yn-1-amine hydrochloride (1:1)
Description:
N-methyl-N-[(2S)-1-phenylpropan-2-yl]prop-2-yn-1-amine hydrochloride, with the CAS number 4528-52-3, is a chemical compound that belongs to the class of substituted amines. This substance features a propargyl amine structure, characterized by the presence of a propyne moiety and a chiral center, which contributes to its stereochemical properties. The compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in organic synthesis and medicinal chemistry. Its molecular structure includes a methyl group and a phenyl group, which can influence its biological activity and interaction with receptors. The presence of the amine functional group suggests potential basicity, allowing it to participate in various chemical reactions, including alkylation and acylation. As with many amines, it may exhibit properties such as being a potential neurotransmitter or modulator, although specific biological activities would depend on further research and context. Proper handling and safety measures are essential due to its chemical nature.
Formula:C13H18ClN
InChI:InChI=1/C13H17N.ClH/c1-4-10-14(3)12(2)11-13-8-6-5-7-9-13;/h1,5-9,12H,10-11H2,2-3H3;1H/t12-;/m0./s1
SMILES:C#CCN(C)[C@@H](C)Cc1ccccc1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Selegiline EP Impurity E-d4 HCl (D-(+)-Deprenyl-d4 HCl)
CAS:Formula:C13H13D4N·HClMolecular weight:191.31 36.46S-(+)-Deprenyl Hydrochloride
CAS:Controlled ProductApplications S-(+)-Deprenyl is the S-enantiomer of Deprenyl. R-(-)-Deprenyl (D288641) is in pharmaceutical formulations.
References Fukui, K., et al.: Science, 218, 747 (1982), Tekes, K., et al.: Pol. J. Pharmacol. Pharm., 40, 653 (1988), Tarjanyi, Z., et al.: J. Pharm. Biomed. Anal., 17, 725 (1998), Kim, E., et al.: J. Anal. Toxicol., 24, 238 (2000),Formula:C13H17N·ClHColor and Shape:White To Off-WhiteMolecular weight:223.74

