CAS 453557-49-8

2,5-dimethyl-1-(4H-1,2,4-triazol-4-yl)-1H-pyrrole-3-carbaldehyde

Description:

2,5-Dimethyl-1-(4H-1,2,4-triazol-4-yl)-1H-pyrrole-3-carbaldehyde is a chemical compound characterized by its unique structure, which includes a pyrrole ring and a triazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents, reflecting its polar functional groups. The presence of the aldehyde functional group suggests it may participate in various chemical reactions, including condensation and oxidation. Additionally, the triazole ring can contribute to biological activity, making this compound of interest in medicinal chemistry and agricultural applications. Its molecular structure allows for potential interactions with biological targets, which may lead to pharmacological effects. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2,5-dimethyl-1-(4H-1,2,4-triazol-4-yl)-1H-pyrrole-3-carbaldehyde represents a versatile scaffold for further chemical modifications and applications in research and development.

Formula: C₉H₁₀N₄O

InChI: InChI=1/C9H10N4O/c1-7-3-9(4-14)8(2)13(7)12-5-10-11-6-12/h3-6H,1-2H3

SMILES: Cc1cc(C=O)c(C)n1n1cnnc1

2,5-Dimethyl-1-(4H-1,2,4-triazol-4-yl)-1H-pyrrole-3-carbaldehyde

CAS: 453557-49-8

2,5-Dimethyl-1-(4H-1,2,4-triazol-4-yl)-1H-pyrrole-3-carbaldehyde

Purity: 95%

Molecular weight: 190.20g/mol

Ref: 54-OR32900