CAS 453557-67-0
:2,2,2-Trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]ethanone
Description:
2,2,2-Trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]ethanone, with the CAS number 453557-67-0, is a synthetic organic compound characterized by its complex structure, which includes a trichloroacetyl group and a pyrrole moiety substituted with a fluorobenzoyl group. This compound typically exhibits properties such as high stability due to the presence of multiple halogen atoms, which can enhance its reactivity in certain chemical reactions. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or agrochemicals, given its structural features that may interact with biological systems. The presence of chlorine and fluorine atoms suggests that it may have unique electronic properties, influencing its behavior in chemical reactions and interactions with other substances. Additionally, the compound's synthesis and handling require careful consideration of safety protocols due to the toxicity associated with halogenated compounds. Overall, 2,2,2-Trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]ethanone represents a specialized chemical with potential utility in various fields of research and industry.
Formula:C13H7Cl3FNO2
InChI:InChI=1S/C13H7Cl3FNO2/c14-13(15,16)12(20)10-5-8(6-18-10)11(19)7-1-3-9(17)4-2-7/h1-6,18H
InChI key:InChIKey=DSGDPASOJJFYRF-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C(C(Cl)(Cl)Cl)=O)NC1)C2=CC=C(F)C=C2
Synonyms:- Ethanone, 2,2,2-trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-
- 2,2,2-Trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]ethanone
- 2,2,2-Trichloro-1-[4-(4-fluorobenzoyl)-1H-pyrrol-2-yl]-1-ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4-Fluorobenzoyl)-2-(trichloroacetyl)-1H-pyrrole
CAS:4-(4-Fluorobenzoyl)-2-(trichloroacetyl)-1H-pyrrole
Molecular weight:334.56g/mol
