CymitQuimica logo

CAS 453557-77-2

:

4-Chloro-2-fluoro-5-[(4-fluorophenyl)methoxy]benzenamine

Description:
4-Chloro-2-fluoro-5-[(4-fluorophenyl)methoxy]benzenamine, with the CAS number 453557-77-2, is an organic compound characterized by its complex aromatic structure. It features a benzene ring substituted with a chloro group, a fluoro group, and a methoxy group linked to a para-fluorophenyl moiety. This compound is typically classified as an aniline derivative due to the presence of the amine functional group. The presence of multiple halogen substituents (chlorine and fluorine) can influence its chemical reactivity, solubility, and potential biological activity. Such compounds are often of interest in medicinal chemistry and materials science due to their unique electronic properties and potential applications in pharmaceuticals or agrochemicals. The specific arrangement of substituents can also affect the compound's polarity and interaction with biological targets, making it a subject of study in drug design and development. Overall, 4-Chloro-2-fluoro-5-[(4-fluorophenyl)methoxy]benzenamine exemplifies the complexity and utility of halogenated aromatic compounds in various chemical applications.
Formula:C13H10ClF2NO
InChI:InChI=1S/C13H10ClF2NO/c14-10-5-11(16)12(17)6-13(10)18-7-8-1-3-9(15)4-2-8/h1-6H,7,17H2
InChI key:InChIKey=CSGZATUSAFETSN-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(F)C=C1)C2=C(Cl)C=C(F)C(N)=C2
Synonyms:
  • 4-Chloro-2-fluoro-5-[(4-fluorophenyl)methoxy]benzenamine
  • Benzenamine, 4-chloro-2-fluoro-5-[(4-fluorophenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.