CAS 4537-13-7
:decan-2-ylbenzene
Description:
Decan-2-ylbenzene, also known by its CAS number 4537-13-7, is an organic compound characterized by a long aliphatic chain attached to a benzene ring. It belongs to the class of alkylbenzenes, where the decan-2-yl group (a decane chain with a branching at the second carbon) is linked to the aromatic benzene structure. This compound is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. Its molecular structure contributes to its hydrophobic properties, making it useful in various applications, including as a solvent or in the synthesis of other organic compounds. The presence of both aliphatic and aromatic components in decan-2-ylbenzene can influence its physical properties, such as boiling and melting points, as well as its reactivity. Additionally, it may exhibit moderate volatility and can be subject to environmental considerations due to its potential persistence and bioaccumulation in ecosystems.
Formula:C16H26
InChI:InChI=1/C16H26/c1-3-4-5-6-7-9-12-15(2)16-13-10-8-11-14-16/h8,10-11,13-15H,3-7,9,12H2,1-2H3
SMILES:CCCCCCCCC(C)c1ccccc1
Synonyms:- (1-Methylnonyl)benzene
- 2-Phenyldecane
- Benzene, (1-Methylnonyl)-
- Decan-2-ylbenzene
- (2-Decyl)benzene
- ecan-2-ylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(2-Decyl)benzene
CAS:Controlled ProductApplications (2-Decyl)benzene is a linear alkylbenzene used to synthesize aryl olefins.
References Faghihian, H., et al.: App. Surface. Sci., 264, 492 (2013);Formula:C16H26Color and Shape:NeatMolecular weight:218.3776

