CAS 4537-73-9
:pyrimidine-2-carbothioamide
Description:
Pyrimidine-2-carbothioamide is a heterocyclic organic compound characterized by the presence of a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carbothioamide functional group (-C(=S)NH2) attached to the second carbon of the pyrimidine ring, which contributes to its reactivity and potential applications in various chemical reactions. Pyrimidine-2-carbothioamide is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amine group. The compound can participate in nucleophilic substitution reactions and may serve as a precursor for the synthesis of more complex molecules. Its derivatives are of interest in medicinal chemistry, particularly for their potential biological activities, including antimicrobial and antitumor properties. As with many nitrogen-containing heterocycles, pyrimidine-2-carbothioamide's properties can be influenced by substituents and the overall molecular structure, making it a versatile compound in organic synthesis and pharmaceutical research.
Formula:C5H5N3S
InChI:InChI=1/C5H5N3S/c6-4(9)5-7-2-1-3-8-5/h1-3H,(H2,6,9)
SMILES:c1cnc(C(=S)N)nc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyrimidine-2-thiocarboxamide, 97%
CAS:Pyrimidine-2-thiocarboxamide is used as a pharmaceutical intermediate and as a synthetic building block. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AFormula:C5H5N3SPurity:97%Molecular weight:139.172-Pyrimidinecarbothioamide (9CI)
CAS:Formula:C5H5N3SPurity:98%Color and Shape:SolidMolecular weight:139.1783Pyrimidine-2-carbothioamide
CAS:Formula:C5H5N3SPurity:98%Color and Shape:SolidMolecular weight:139.18



