CAS 454-16-0
:2-Fluoro-5-nitroanisole
Description:
2-Fluoro-5-nitroanisole is an organic compound characterized by the presence of a fluorine atom, a nitro group, and a methoxy group attached to a benzene ring. Its molecular structure features a fluorine atom at the 2-position and a nitro group at the 5-position relative to the methoxy group, which is located at the 1-position of the aromatic ring. This compound is typically a pale yellow solid and is known for its moderate solubility in organic solvents. It exhibits properties typical of nitro-substituted aromatic compounds, including potential reactivity in electrophilic substitution reactions. The presence of both the nitro and fluoro groups can influence its electronic properties, making it a useful intermediate in organic synthesis and pharmaceuticals. Additionally, 2-fluoro-5-nitroanisole may exhibit biological activity, which can be of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with many nitro compounds, it may pose health and environmental risks.
Formula:C7H6FNO3
InChI:InChI=1/C7H6FNO3/c1-12-7-4-5(9(10)11)2-3-6(7)8/h2-4H,1H3
SMILES:COc1cc(ccc1F)N(=O)=O
Synonyms:- 2-Fluoro-5-nitrophenyl methyl ether
- 4-Fluoro-3-methoxynitrobenzene
- Benzene, 1-fluoro-2-methoxy-4-nitro-
- 1-Fluoro-2-Methoxy-4-Nitrobenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Fluoro-2-methoxy-4-nitrobenzene
CAS:Formula:C7H6FNO3Purity:97%Color and Shape:SolidMolecular weight:171.12582-Fluoro-5-nitroanisole
CAS:2-Fluoro-5-nitroanisoleFormula:C7H6FNO3Purity:≥95%Color and Shape: light yellow/orange solidMolecular weight:171.13g/mol2-Fluoro-5-nitroanisole
CAS:2-Fluoro-5-nitroanisole is a prophylactic agent that has been shown to be effective in protecting Rhesus monkeys against malaria. It is also an analog of chloroquine, which has been used as a prophylactic agent against malaria. 2-Fluoro-5-nitroanisole prevents the development of malaria by interfering with the growth and reproduction of plasmodium. The mechanism may be due to its ability to inhibit the synthesis of DNA, RNA and protein in the parasite's host cell, leading to schizonticidal activity and death.Formula:C7H6FNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:171.13 g/mol4-Fluoro-3-methoxynitrobenzene
CAS:Formula:C7H6FNO3Purity:97%Color and Shape:Yellow powderMolecular weight:171.1272-Fluoro-5-nitroanisole
CAS:Controlled ProductApplications 2-Fluoro-5-nitroanisole
Formula:C7H6FNO3Color and Shape:NeatMolecular weight:171.13




