CAS 4541-32-6

2,2-Dimethylcyclopentanone

Description:

2,2-Dimethylcyclopentanone is a cyclic ketone characterized by its unique structure, which features a cyclopentane ring with two methyl groups attached to the second carbon. This compound has a molecular formula of C8H14O and a molecular weight of approximately 126.20 g/mol. It is typically a colorless to pale yellow liquid with a distinctive odor, often described as sweet or pleasant. The compound is soluble in organic solvents such as ethanol and ether but has limited solubility in water. 2,2-Dimethylcyclopentanone exhibits moderate volatility and can be flammable, necessitating careful handling and storage. Its chemical properties include reactivity typical of ketones, allowing it to participate in various organic reactions, such as nucleophilic additions. This compound is utilized in organic synthesis and may serve as an intermediate in the production of fragrances, flavors, and other chemical products. Safety data sheets should be consulted for specific handling and exposure guidelines, as with any chemical substance.

Formula: C₇H₁₂O

InChI: InChI=1/C7H12O/c1-7(2)5-3-4-6(7)8/h3-5H2,1-2H3

SMILES: CC1(C)CCCC1=O

2,2-Dimethylcyclopentanone

CAS: 4541-32-6

Formula: C₇H₁₂O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 112.1696

Ref: IN-DA003984

2,2-Dimethylcyclopentanone

CAS: 4541-32-6

2,2-Dimethylcyclopentanone

Purity: 97%

Color and Shape: Liquid

Molecular weight: 112.17g/mol

Ref: 54-OR939516

2,2-Dimethylcyclopentanone

CAS: 4541-32-6

Formula: C₇H₁₂O

Purity: >95.0%(GC)

Color and Shape: Colorless to Light yellow clear liquid

Molecular weight: 112.17

Ref: 3B-D5988

2,2-Dimethylcyclopentanone

CAS: 4541-32-6

Formula: C₇H₁₂O

Purity: ≥ 96%

Color and Shape: Colourless liquid

Molecular weight: 112.17

Ref: 7W-GK8315

2,2-Dimethylcyclopentanone

CAS: 4541-32-6

Formula: C₇H₁₂O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 112.172

Ref: 10-F050693