CAS 45434-02-4
:[1-(aminomethyl)cyclopropyl]methanol
Description:
[1-(Aminomethyl)cyclopropyl]methanol, with the CAS number 45434-02-4, is an organic compound characterized by its unique cyclopropyl structure combined with an aminomethyl group and a hydroxymethyl group. This compound features a three-membered cyclopropane ring, which contributes to its strain and reactivity. The presence of the aminomethyl group introduces basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The hydroxymethyl group enhances its solubility in polar solvents and can act as a functional group for further chemical modifications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in synthesizing more complex molecules or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C5H11NO
InChI:InChI=1/C5H11NO/c6-3-5(4-7)1-2-5/h7H,1-4,6H2
SMILES:C1CC1(CN)CO
Synonyms:- Cyclopropanemethanol, 1-(Aminomethyl)-
- [1-(AMINOMETHYL)CYCLOPROPYL]METHANO
- OTAVA-BB 1146304
- [1-(AMINOMETHYL)CYCLOPROPYL]METHANOL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(1-(Aminomethyl)cyclopropyl)methanol
CAS:Formula:C5H11NOPurity:96%Color and Shape:LiquidMolecular weight:101.1469Ref: IN-DA00376O
1g55.00€5g138.00€25g647.00€50gTo inquire100gTo inquire250gTo inquire25mg25.00€100mg28.00€250mg40.00€[1-(Aminomethyl)cyclopropyl]methanol
CAS:[1-(Aminomethyl)cyclopropyl]methanolFormula:C5H11NOPurity:98%Color and Shape: yellow to light orange liquidMolecular weight:101.15g/mol[1-(aminomethyl)cyclopropyl]methanol
CAS:Formula:C5H11NOPurity:95%Color and Shape:LiquidMolecular weight:101.149[1-(Aminomethyl)cyclopropyl]methanol
CAS:Please enquire for more information about [1-(Aminomethyl)cyclopropyl]methanol including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C5H11NOPurity:Min. 95%Molecular weight:101.15 g/molRef: 3D-FA120554
Discontinued product



