CAS 4546-70-7: 2-Amino-2′-deoxyadenosine
Description:2-Amino-2′-deoxyadenosine, with the CAS number 4546-70-7, is a nucleoside analog of adenosine, characterized by the presence of an amino group at the 2-position of the ribose sugar. This compound features a purine base, adenine, linked to a deoxyribose sugar, which lacks a hydroxyl group at the 2' position, distinguishing it from ribonucleosides. The amino substitution can influence its biological activity, making it of interest in various biochemical and pharmacological studies. 2-Amino-2′-deoxyadenosine is soluble in water and exhibits properties typical of nucleosides, such as the ability to participate in hydrogen bonding and base pairing. Its structural modifications can affect its interaction with enzymes and receptors, potentially impacting nucleic acid synthesis and cellular signaling pathways. This compound is often studied for its potential therapeutic applications, including antiviral and anticancer properties, due to its ability to mimic natural nucleosides in biological systems.
Formula:C10H14N6O3
InChI:InChI=1S/C10H14N6O3/c11-8-7-9(15-10(12)14-8)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H4,11,12,14,15)/t4-,5+,6+/m0/s1
InChI key:InChIKey=NOLHIMIFXOBLFF-KVQBGUIXSA-N
SMILES:OCC1OC(N2C=NC=3C(=NC(=NC32)N)N)CC1O
- Synonyms:
- Adenosine, 2-amino-2′-deoxy-
- 9H-Purine, 2,6-diamino-9-(2-deoxy-β-D-erythro-pentofuranosyl)-
- 2-Amino-2′-deoxyadenosine
- 2,6-Diamino-9-(2-deoxy-β-D-erythro-pentofuranosyl)purine
- 2,6-Diaminopurine deoxyriboside
