CAS 4546-72-9: N-Benzoyl-2′-deoxyadenosine
Description:N-Benzoyl-2′-deoxyadenosine is a modified nucleoside that features a benzoyl group attached to the nitrogen atom of the adenine base, specifically at the 2′ position of the deoxyribose sugar. This compound is characterized by its structural components, which include a purine base (adenine), a deoxyribose sugar, and a benzoyl moiety. It is typically used in biochemical research and studies related to nucleic acid chemistry, particularly in the context of DNA synthesis and modification. The presence of the benzoyl group can influence the compound's solubility, stability, and interaction with other biomolecules. N-Benzoyl-2′-deoxyadenosine may also exhibit unique biological activities, making it of interest in pharmacological studies. Its CAS number, 4546-72-9, serves as a unique identifier for this substance in chemical databases, facilitating its identification and research. Overall, this compound exemplifies the diverse modifications that can be made to nucleosides to explore their properties and potential applications in various scientific fields.
Formula:C17H17N5O4
InChI:InChI=1S/C17H17N5O4/c23-7-12-11(24)6-13(26-12)22-9-20-14-15(18-8-19-16(14)22)21-17(25)10-4-2-1-3-5-10/h1-5,8-9,11-13,23-24H,6-7H2,(H,18,19,21,25)/t11-,12+,13+/m0/s1
InChI key:InChIKey=PIXHJAPVPCVZSV-YNEHKIRRSA-N
SMILES:O=C(NC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3)C=4C=CC=CC4
- Synonyms:
- 4-(Benzoylamino)-1-(2-deoxy-beta-L-erythro-pentofuranosyl)-2(1H)-pyrimidinone
- 6-N-Benzoyldeoxyadenosine
- Adenosine, N-benzoyl-2′-deoxy-
- Benzamide, N-[9-(2-deoxy-β-<span class="text-smallcaps">D</span>-erythro-pentofuranosyl)-9H-purin-6-yl]-
- N-Benzoyldeoxyadenosine
- N-benzoyl-2'-deoxyadenosine
- N6-Benzoyl-2'-deoxyadenosine
- N6-Benzoyl-2-deoxyadenosine (dA-Bz)
- N6-benzoyl-2'-deoxyadenosine hydrate
- N<sup>6</sup>-Benzoyl-2′-deoxyadenosine
- See more synonyms
- N<sup>6</sup>-Benzoyldeoxyadenosine
- dA-Bz
- Benzamide, N-[9-(2-deoxy-β-D-erythro-pentofuranosyl)-9H-purin-6-yl]-
- N6-Benzoyldeoxyadenosine
- Bz-dA
