CymitQuimica logo

CAS 4546-73-0

:

5-amino-3-(2-deoxypentofuranosyl)-2,3-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one

Description:
5-amino-3-(2-deoxypentofuranosyl)-2,3-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one is a complex organic compound characterized by its unique triazolo-pyrimidine structure, which incorporates a 2-deoxypentofuranosyl moiety. This compound features an amino group that contributes to its potential biological activity, particularly in the context of nucleoside analogs. The presence of the triazole ring enhances its stability and may influence its interaction with biological targets, such as enzymes or receptors. The compound is likely to exhibit solubility in polar solvents due to the presence of the amino and sugar components. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. The CAS number 4546-73-0 allows for easy identification and retrieval of information related to this substance in chemical databases. Overall, this compound represents a significant interest in the field of pharmaceutical chemistry due to its structural complexity and potential therapeutic applications.
Formula:C9H12N6O4
InChI:InChI=1/C9H12N6O4/c10-9-11-7-6(8(18)12-9)13-14-15(7)5-1-3(17)4(2-16)19-5/h3-5,14,16-17H,1-2H2,(H2,10,12,18)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.