CAS 4547-57-3
:4-Butoxybenzeneacetic acid
Description:
4-Butoxybenzeneacetic acid, also known by its CAS number 4547-57-3, is an organic compound characterized by its aromatic structure and functional groups. It features a butoxy group attached to a benzene ring, along with an acetic acid moiety, which contributes to its acidic properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water due to its hydrophobic butoxy group. 4-Butoxybenzeneacetic acid may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its properties, including melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, 4-Butoxybenzeneacetic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H16O3
InChI:InChI=1S/C12H16O3/c1-2-3-8-15-11-6-4-10(5-7-11)9-12(13)14/h4-7H,2-3,8-9H2,1H3,(H,13,14)
InChI key:InChIKey=KLJMYYFCWBVKEE-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=C(OCCCC)C=C1
Synonyms:- (4-Butoxyphenyl)Acetate
- (p-Butoxyphenyl)acetic acid
- 2-(4-Butoxyphenyl)acetic acid
- 4-(n-Butoxy)phenylacetic acid
- 4-Butoxybenzeneacetic acid
- 4-n-Butoxybenzeneacetic acid
- 4-n-Butoxyphenylacetic acid
- Acetic acid, (p-butoxyphenyl)-
- Benzeneacetic acid, 4-butoxy-
- 4-Butoxyphenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Butoxyphenylacetic Acid
CAS:Formula:C12H16O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:208.26(4-n-Butoxyphenyl)acetic acid
CAS:Formula:C12H16O3Purity:95%Color and Shape:SolidMolecular weight:208.25364-(n-Butoxy)Phenylacetic Acid
CAS:4-(n-Butoxy)Phenylacetic AcidPurity:99%Molecular weight:208.25g/mol2-(4-Butoxyphenyl)acetic Acid
CAS:Controlled ProductFormula:C12H16O3Color and Shape:NeatMolecular weight:208.254-(N-Butoxy)phenyl acetic acid
CAS:4-(N-Butoxy)phenyl acetic acid is a hydroxamic acid that has been shown to be mutagenic in Salmonella typhimurium. 4-(N-Butoxy)phenyl acetic acid is a ligand that binds to the metal atom of the enzyme hydroxylamine, preventing it from binding to other compounds. This results in an increase in the production of hydroxylamine, which leads to DNA damage and cell death. 4-(N-Butoxy)phenyl acetic acid also has catalytic properties and can interact with chloride ions, due to its electronegativity.
Formula:C12H16O3Purity:Min. 98 Area-%Color and Shape:Off-White PowderMolecular weight:208.25 g/mol







